Which of these pure compounds has hydrogen bonding in the liquid state?
1,1,1-trichloroethane, CH3CCl3
trimethylamine, (CH3)3N
hydrogen fluoride, HF
hydrogen sulfide, H2S
Was this exam question helpful?
Exam code: XCH11
Select a download format for Intermolecular Forces
Select an answer set to view for
Intermolecular Forces
Which of these pure compounds has hydrogen bonding in the liquid state?
1,1,1-trichloroethane, CH3CCl3
trimethylamine, (CH3)3N
hydrogen fluoride, HF
hydrogen sulfide, H2S
Choose your answer
Was this exam question helpful?
Which of these isomers has the highest boiling temperature?

Choose your answer
Was this exam question helpful?
This question is about alkanes.
Which of these alkanes has the highest boiling temperature?
butane
hexane
pentane
propane
Choose your answer
Which of these alkanes has the lowest boiling temperature?
(1)

Choose your answer
Was this exam question helpful?
Which of these isomers with the formula C8H18 has the lowest boiling temperature?
CH3CH(CH3)CH2CH2CH(CH3)CH3
CH3CH(CH3)CH2CH2CH2CH2CH3
CH3C(CH3)2CH2CH(CH3)CH3
CH3CH2CH2CH2CH2CH2CH2CH3
Choose your answer
Was this exam question helpful?
Which sequence shows the molecules in order of increasing boiling temperature?
H2O < Br2 < Cl2 < CH4
Br2 < CH4 < Cl2 < H2O
Cl2 < CH4 < H2O < Br2
CH4 < Cl2 < Br2 < H2O
Choose your answer
Was this exam question helpful?
The viscosities of four liquid organic compounds are compared by placing the liquids in separate identical tubes, each with an air bubble at the top.

The tubes are inverted, and the times measured for the air bubble to travel the length of the tube. For which compound does the air bubble take the longest time?

Choose your answer
Was this exam question helpful?
Which is not correct about ice?
ice has a lower density than water
H2O molecules are further apart in ice than in water
the H−O−H bond angle is the same in ice and in water
H2O molecules in ice are held together by hydrogen bonds
Choose your answer
Was this exam question helpful?
Which intermolecular forces exist between the molecules of the compound shown?

hydrogen bonding and London forces only
hydrogen bonding and permanent dipole‐permanent dipole forces only
London forces and permanent dipole‐permanent dipole forces only
hydrogen bonding, permanent dipole‐permanent dipole forces and London forces
Choose your answer
Was this exam question helpful?
Which solvent dissolves the greatest amount of hydrocarbon C35H72?
butan‐1‐ol
ethanoic acid
hexane
water
Choose your answer
Was this exam question helpful?
Which row shows the hydrogen halides in order of increasing boiling temperature?
|
| Lowest | |||
☐ | A | HF | HCl | HBr | HI |
☐ | B | HI | HBr | HCl | HF |
☐ | C | HCl | HBr | HI | HF |
☐ | D | HF | HI | HBr | HCl |
Choose your answer
Was this exam question helpful?
Pentane and 2,2-dimethylpropane are structural isomers with molecular formula C5H12.
Alkane | Boiling point / °C |
|---|---|
Pentane | +36 |
2,2-dimethylpropane | +9 |
Why does pentane have the higher boiling point?
Pentane has more electrons
Pentane has permanent dipole–dipole forces
Pentane has stronger covalent bonds
Pentane has greater surface contact between its molecules
Choose your answer
Was this exam question helpful?