Primary Aliphatic Amines (Edexcel A Level Chemistry): Revision Note
Exam code: 9CHO
Reactions of Primary Aliphatic Amines
Reactions with water
The first few members of the homologous series of primary aliphatic amines are miscible with water
However as the hydrocarbon part of the molecule becomes longer, the solubility decreases
Phenylamine is only slightly soluble in water
They dissolve in water as they are able to form hydrogen bonds with water molecules
Amines also react slightly with water to form alkaline solutions
CH3NH2 + H2O ⇌ CH3NH3+ + OH-
Reactions with acids
Amines react with strong acids to form ionic ammonium salts
CH3NH2 (aq) + HCl (aq) → CH3NH3+Cl- (aq) Methylamine methylammonium chloride
Addition of NaOH to an ammonium salt will convert it back to the amine
These ionic salts will be solid crystals, if the water is evaporated, because of the strong ionic interactions
The ionic salts formed in this reaction means that the compounds are soluble in the acid
e.g. Phenylamine is not very soluble in water but phenylammonium chloride is soluble
Reactions with ethanoyl chloride
This reaction type is addition-elimination reaction meaning two molecules join together, and then a small molecule is eliminated - in these examples, hydrogen chloride
You do not need to know the mechanism of these reactions
The organic product contains a new functional group - amide - in which a carbonyl group is next to an NH group
The equation for the reaction of butylamine with ethanoyl chloride is
CH3COCl + CH3CH2CH2CH2NH2 → CH3CONHCH2CH2CH2CH3 + HCl
Reaction with halogenoalkanes
Again you do not need to know the mechanism for these reactions
The electron-deficient carbon atom in the halogenoalkane and the electron-rich atom nitrogen atom in the amine causes these two species to react together
The general formula for this reaction would be
R'NH2 + R"X → R'NHR" + HX
Where R' is the alkyl group in the amine and R" is the alkyl group in the halogenoalkane
This reaction is an example of a substitution reaction
The organic product is a secondary amine and the inorganic product is a hydrogen halide, often hydrogen chloride
As an example, the equation for the reaction of butylamine and chloroethane is
CH3CH2CH2CH2NH2 + CH3CH2Cl → CH3CH2CH2CH2NHCH2CH3 + HCl
The organic product contains an electron-rich nitrogen atom, so can also react with chloroethane
CH3CH2CH2CH2NHCH2CH3 + CH3CH2Cl → CH3CH2CH2CH2N(CH2CH3)2 + HCl
The organic product of this reaction is a tertiary amine
The organic product also contains an electron-rich nitrogen atom, so can also react with chloroethane
CH3CH2CH2CH2N(CH2CH3)2 + CH3CH2Cl → CH3CH2CH2CH2N+(CH2CH3)3Cl-
In this reaction HCl is not formed because this would require the loss of H from the nitrogen from the organic reactant, which the tertiary amine doesn't have
The product is an ionic compound related to ammonium chloride except that all the hydrogens in the ammonium ion have been replaced by alkyl groups
This is known as a quaternary ammonium salt
Reactions with copper(II) ions
Ammonia can act as a lone pair donor in its reactions with transition metal ions
For example the overall equation for the reaction of ammonia with hexaaquacopper(II) ions is
[Cu(H2O)6]2+ + 4NH3→ [Cu(NH3)4(H2O)2]2+ + 4H2O
Amines also have a lone pair of electrons on the nitrogen, so can take part in similar reactions
The observations are the same as with ammonia
A blue precipitate forms
With excess butylamine the precipitate dissolves to give a blue solution
Formation of the pale blue precipitate
[Cu(H2O)6]2+ + 2CH3CH2CH2CH2NH2 → [Cu(H2O)4(OH)2] + 2CH3CH2CH2CH2NH3+
Formation of the deep blue solution
[Cu(H2O)4(OH)2] + 4CH3CH2CH2CH2NH2 → [Cu(CH3CH2CH2CH2NH2)4(H2O)2]2+ + 2H2O +2OH-
Preparation of Primary Aliphatic Amines
Preparing Amines
Primary amines can be prepared from different reactions including:
The reaction of halogenoalkanes with ammonia
The reduction of nitriles
Reaction of halogenoalkanes with ammonia
This is a nucleophilic substitution reaction in which the nitrogen lone pair in ammonia acts as a nucleophile and replaces the halogen in the halogenoalkane
When a halogenoalkane is reacted with excess, hot ethanolic ammonia under pressure a primary amine is formed

Formation of primary amine
Reduction of nitriles
Nitriles contain a -CN functional group which can be reduced to an -NH2 group
The nitrile vapour and hydrogen gas are passed over a nickel catalyst or LiAlH4 in dry ether can be used to form a primary amine

Nitriles can be reduced with LiAlH4 or H2 and Ni catalyst
Unlock more, it's free!
Was this revision note helpful?
Build on this topic